instruction stringlengths 51 2.18k | output stringlengths 1 833 | input stringclasses 1
value |
|---|---|---|
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation ... | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, non-alc... | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apopt... | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts tang... | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcohol... | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, aging, and tangier ... | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both non-... | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure that impacts both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both tangier disease and d... | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure that impacts both barth syndrome and aging. The molecule is a cholesterol translocation and apoptosis, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylatio... | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing... | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both aging and diabetic heart disease. The molecule is a proto... | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure and cholesterol translocation, and it impacts aging. The molecule is a apoptosis that impacts both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative... | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts diabetic heart disease. The ... | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structur... | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure th... | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
Generate a molecule based on this description: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, and tangier disease. The molecule is a a... | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidas... | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: It impacts aging. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol... | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation. The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxi... | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosph... | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a energy source and a energy storage that impacts metabolic syndrome, cancer, and obesity. The molecule is a membrane stabilizer, fat storage, nutrient that belongs to the thyroxine treatment class of molecules and impacts both atheroscle... | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a membrane stabilizer, fat storage, energy storage that impacts pancreatitis and cancer. The molecule is a energy source, thyroxine treatment, inflammatory that impacts atherosclerosis, cardiovascular disease, and metabolic sy... | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a thyroxine treatment that impacts pancreatitis. The molecule is a membrane stabilizer and a nutrient, which has an effect on cancer and impacts both obesity and metabolic syndrome. The molecule is a energy source, energy storage, inflammatory, fat ... | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient, fat storage, energy storage that impacts pancreatitis and atherosclerosis. The molecule is a energy source and inflammatory, affecting cancer, and impacting obesity, metabolic syndrome, and cardiovascular disease. ... | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient, a inflammatory, and a energy source, and it impacts pancreatitis. The molecule is a thyroxine treatment that impacts cardiovascular disease, obesity, cancer, and atherosclerosis. The molecule is a energy storage, a... | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a tgr5 agonist. Please represent the molecule in SMILES. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: It belongs to the tgr5 agonist class of molecules. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
Could you please return a molecule that adheres to this description? It belongs to the tgr5 agonist class of molecules. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
The molecule is a tgr5 agonist. Use the above information to create a molecule. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
The molecule is a tgr5 agonist. Use the above information to create a molecule. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
Can you create a molecule that matches the given characteristics? The molecule is a fat storage and a nutrient, which impacts atherosclerosis, metabolic syndrome, and cardiovascular disease, and is characterized as thyroxine treatment. It impacts pancreatitis. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a nutrient. The molecule is a fat storage and thyroxine treatment, impacting metabolic syndrome, cardiovascular disease, atherosclerosis, and pancreatitis. Please represent the molecule in SMILES. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
The molecule is a fat storage and a nutrient that impacts atherosclerosis, cardiovascular disease, thyroxine treatment, and metabolic syndrome. It impacts pancreatitis. Use the above information to create a molecule. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: The molecule is a nutrient and fat storage, and it impacts cardiovascular disease. It impacts atherosclerosis, thyroxine treatment, metabolic syndrome, and pancreatitis. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is thyroxine treatment and it impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and a nutrient, impacting both atherosclerosis and cardiovascular disease. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that imp... | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mi... | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase that impacts both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both barth syndrome and aging. The molecule is a cholestero... | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Conceptualize a molecule that meets the specified attribute(s): It impacts both tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts aging. The molecule is a cholesterol translocation and a proton ... | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impa... | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
It impacts both inflammatory disease treatment and pain treatment. Use the above information to create a molecule. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
The molecule is inflammatory disease treatment and it impacts pain treatment. Use the above information to create a molecule. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a inflammatory disease treatment member of the pain treatment class. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
Could you please return a molecule that adheres to this description? The molecule is inflammatory disease treatment and pain treatment. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
Could you please return a molecule that adheres to this description? It impacts both pain treatment and inflammatory disease treatment. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy source. The molecule is a fat storage and a inflammatory that impacts cancer, pancreatitis, cardiovascular disease, and metabolic syndrome. The molecule is a membrane stabilizer, energy storage, nutrient that belongs ... | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source, fat storage, energy storage, membrane stabilizer that impacts cardiovascular disease and pancreatitis. The molecule is a nutrient and inflammatory, and it i... | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
The molecule is a membrane stabilizer, thyroxine treatment, energy storage, energy source that impacts metabolic syndrome and atherosclerosis. It impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a nutrient, a inflammatory, and a fat storage, and it impacts cancer. Use the above information to ... | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a membrane stabilizer, nutrient, fat storage that belongs to the thyroxine treatment class of molecules and impacts cardiovascular disease. The molecule is a energy source that impacts atherosclerosis, obesity, and metabolic syndrome. The m... | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a thyroxine treatment, energy storage, and inflammatory that has an effect on cancer and impacts both cardiovascular disease and obesity. The molecule is a energy source, membrane stabilizer, fat storage that impacts metabolic syndrome... | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizin... | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translo... | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing c... | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translo... | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for... | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Could you please return a molecule that adheres to this description? It impacts cardiovascular disease, pancreatitis, obesity, and metabolic syndrome. The molecule is a membrane stabilizer that affects cancer by impacting both thyroxine treatment and atherosclerosis. The molecule is a inflammatory, fat storage, energy ... | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a inflammatory that impacts both metabolic syndrome and atherosclerosis. The molecule is a energy storage and a energy source, impacting both cardiovascular disease and cancer. The molecule is a fat storage, thyroxine treatment, membrane ... | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: It impacts cardiovascular disease. The molecule is a fat storage, energy storage, inflammatory that impacts pancreatitis, cancer, and thyroxine treatment. The molecule is a nutrient, energy source, membrane stabilizer that impact... | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts cardiovascular disease, obesity, and cancer. The molecule is a energy storage and a membrane stabilizer, impacting both pancreatitis and atherosclerosis. The molecule is a fat storage, energy source, inflammator... | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a membrane stabilizer and a fat storage, which has an effect on cancer and impacts both cardiovascular disease and pancreatitis, while being thyroxine treatment. The molecule is a energy source and inflammatory, and it impacts metabolic syndrome. The mo... | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a liquid crystal display and belongs to the liquid crystal class of molecules. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a liquid crystal display and belongs to the liquid crystal class of molecules. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Build a molecule that meets the requirement: The molecule is a liquid crystal that has an effect on liquid crystal display. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Generate a molecule that fulfills the requirement: The molecule is a liquid crystal that has an effect on liquid crystal display. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Generate a molecule that fulfills the requirement: The molecule is both a liquid crystal and a liquid crystal display. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apopto... | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase ... | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. It im... | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a cholesterol translo... | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both bar... | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Generate a molecule based on this description: The molecule is a 11βhsd1 inhibitor that impacts diabetes treatment. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a 11βhsd1 inhibitor and is diabetes treatment. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
Can you create a molecule that matches the given characteristics? The molecule is a 11βhsd1 inhibitor and is diabetes treatment. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
Generate a molecule based on this description: The molecule is a 11βhsd1 inhibitor that impacts diabetes treatment. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
I need a molecule that meets the following conditions: The molecule is a 11βhsd1 inhibitor and is diabetes treatment. Please represent the molecule in SMILES. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
Can you create a molecule that matches the given characteristics? The molecule is a surfactant, a energy source, and a cholesterol translocation, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, emulsifier, membrane stabilizer that impacts non-alcoholic fatty liver dis... | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a membrane stabilizer, a energy storage, a cholesterol translocation, and smooth. The molecule is a nutritional supplement, energy source, food additive, proton trap for oxidative phosphorylation that impacts aging. The molecule is a stabilizing mit... | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source and surfactant, and it impacts diabetic heart disease. The molecule is a nutritional supplement, a emulsifier, and a cholesterol translocation, and it impacts tangier disease. The molecule is a foo... | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a nutritional supplement and a proton trap for oxidative phosphorylation, impacting both tangier disease and non-a... | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a emulsifier, stabilizing mitochondrial structure, energy source, apoptosis that impacts diabetic heart disease and barth syndrome. The molecule is a surfactant, a cholesterol translocation, and a membrane stabilizer. The mole... | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that ... | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both aging and barth syndrome. The molecule is a apoptosis and a stabilizing cytochrom... | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase that impacts both aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a apoptosis, and it impacts tangier disease. The molecule is a ... | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts both barth syndrome and aging. The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a proton trap for oxidative phosphorylation, and it impacts tangier disease. The molecule is a stabilizing mit... | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and ... | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
The molecule is a cholesterol translocation, a apoptosis, and a stabilizing mitochondrial structure. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts both... | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a cholesterol transl... | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase and a apopto... | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: It impacts diabetic heart disease, barth syndrome, and aging. The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxida... | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? It impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation. The molecule is a cholester... | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
The molecule is a nutrient. Use the above information to create a molecule. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 5